C19H20N4O6S — CID 90022480
[3-hydroxy-2-[4-[(4-nitrophenyl)methyl]triazol-1-yl]propyl] 4-methylbenzenesulfonate (PubChem CID 90022480) has the molecular formula C19H20N4O6S and a molecular weight of 432.46 g/mol. Its IUPAC name is [3-hydroxy-2-[4-[(4-nitrophenyl)methyl]triazol-1-yl]propyl] 4-methylbenzenesulfonate.
| Compound Name | [3-hydroxy-2-[4-[(4-nitrophenyl)methyl]triazol-1-yl]propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90022480 |
| Molecular Formula | C19H20N4O6S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | [3-hydroxy-2-[4-[(4-nitrophenyl)methyl]triazol-1-yl]propyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(CO)n2cc(Cc3ccc([N+](=O)[O-])cc3)nn2)cc1 |
| InChI | InChI=1S/C19H20N4O6S/c1-14-2-8-19(9-3-14)30(27,28)29-13-18(12-24)22-11-16(20-21-22)10-15-4-6-17(7-5-15)23(25)26/h2-9,11,18,24H,10,12-13H2,1H3 |
| InChIKey | CVZYNWRKKAENDW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|