C16H22O5S — CID 58923582
[(2S)-2-[(4-methylphenyl)sulfonyloxymethyl]hex-5-enyl] acetate (PubChem CID 58923582) has the molecular formula C16H22O5S and a molecular weight of 326.41 g/mol. Its IUPAC name is [(2S)-2-[(4-methylphenyl)sulfonyloxymethyl]hex-5-enyl] acetate.
| Compound Name | [(2S)-2-[(4-methylphenyl)sulfonyloxymethyl]hex-5-enyl] acetate |
|---|---|
| PubChem CID | 58923582 |
| Molecular Formula | C16H22O5S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [(2S)-2-[(4-methylphenyl)sulfonyloxymethyl]hex-5-enyl] acetate |
| SMILES | C=CCC[C@@H](COC(C)=O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22O5S/c1-4-5-6-15(11-20-14(3)17)12-21-22(18,19)16-9-7-13(2)8-10-16/h4,7-10,15H,1,5-6,11-12H2,2-3H3/t15-/m0/s1 |
| InChIKey | UBDLLSCZQYENKO-HNNXBMFYSA-N |
| XLogP | 2.85 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|