C21H24O7S2 — CID 10766066
[(2S)-2-[(4-methylphenyl)sulfonyloxymethyl]-4-oxobutyl] 2-[(R)-(4-methylphenyl)sulfinyl]acetate (PubChem CID 10766066) has the molecular formula C21H24O7S2 and a molecular weight of 452.55 g/mol. Its IUPAC name is [(2S)-2-[(4-methylphenyl)sulfonyloxymethyl]-4-oxobutyl] 2-[(R)-(4-methylphenyl)sulfinyl]acetate.
| Compound Name | [(2S)-2-[(4-methylphenyl)sulfonyloxymethyl]-4-oxobutyl] 2-[(R)-(4-methylphenyl)sulfinyl]acetate |
|---|---|
| PubChem CID | 10766066 |
| Molecular Formula | C21H24O7S2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | [(2S)-2-[(4-methylphenyl)sulfonyloxymethyl]-4-oxobutyl] 2-[(R)-(4-methylphenyl)sulfinyl]acetate |
| SMILES | Cc1ccc([S@](=O)CC(=O)OC[C@H](CC=O)COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H24O7S2/c1-16-3-7-19(8-4-16)29(24)15-21(23)27-13-18(11-12-22)14-28-30(25,26)20-9-5-17(2)6-10-20/h3-10,12,18H,11,13-15H2,1-2H3/t18-,29+/m0/s1 |
| InChIKey | IJDINMJMLWEMCC-RBSBEOHCSA-N |
| XLogP | 2.56 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|