C15H21ClO4S — CID 141478983
[(Z,2S,3S)-3-chloro-2-hydroxyoct-5-enyl] 4-methylbenzenesulfonate (PubChem CID 141478983) has the molecular formula C15H21ClO4S and a molecular weight of 332.85 g/mol. Its IUPAC name is [(Z,2S,3S)-3-chloro-2-hydroxyoct-5-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(Z,2S,3S)-3-chloro-2-hydroxyoct-5-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 141478983 |
| Molecular Formula | C15H21ClO4S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | [(Z,2S,3S)-3-chloro-2-hydroxyoct-5-enyl] 4-methylbenzenesulfonate |
| SMILES | CC/C=C\C[C@H](Cl)[C@@H](O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H21ClO4S/c1-3-4-5-6-14(16)15(17)11-20-21(18,19)13-9-7-12(2)8-10-13/h4-5,7-10,14-15,17H,3,6,11H2,1-2H3/b5-4-/t14-,15-/m0/s1 |
| InChIKey | LVYRLXSPECJIPW-VQGNRHNMSA-N |
| XLogP | 3.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|