C15H24O4SSi — CID 11012898
[(Z)-2-hydroxy-5-trimethylsilylpent-4-enyl] 4-methylbenzenesulfonate (PubChem CID 11012898) has the molecular formula C15H24O4SSi and a molecular weight of 328.51 g/mol. Its IUPAC name is [(Z)-2-hydroxy-5-trimethylsilylpent-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(Z)-2-hydroxy-5-trimethylsilylpent-4-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11012898 |
| Molecular Formula | C15H24O4SSi |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [(Z)-2-hydroxy-5-trimethylsilylpent-4-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(O)C/C=C\[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C15H24O4SSi/c1-13-7-9-15(10-8-13)20(17,18)19-12-14(16)6-5-11-21(2,3)4/h5,7-11,14,16H,6,12H2,1-4H3/b11-5- |
| InChIKey | GGRYRDLFIRGEKZ-WZUFQYTHSA-N |
| XLogP | 2.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|