C22H30O5S — CID 169074608
[(3S,4E,6E,8E,10S,12Z)-3,10-dihydroxypentadeca-4,6,8,12-tetraenyl] 4-methylbenzenesulfonate (PubChem CID 169074608) has the molecular formula C22H30O5S and a molecular weight of 406.54 g/mol. Its IUPAC name is [(3S,4E,6E,8E,10S,12Z)-3,10-dihydroxypentadeca-4,6,8,12-tetraenyl] 4-methylbenzenesulfonate.
| Compound Name | [(3S,4E,6E,8E,10S,12Z)-3,10-dihydroxypentadeca-4,6,8,12-tetraenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 169074608 |
| Molecular Formula | C22H30O5S |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | [(3S,4E,6E,8E,10S,12Z)-3,10-dihydroxypentadeca-4,6,8,12-tetraenyl] 4-methylbenzenesulfonate |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C/C=C/[C@@H](O)CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H30O5S/c1-3-4-7-10-20(23)11-8-5-6-9-12-21(24)17-18-27-28(25,26)22-15-13-19(2)14-16-22/h4-9,11-16,20-21,23-24H,3,10,17-18H2,1-2H3/b6-5+,7-4-,11-8+,12-9+/t20-,21+/m0/s1 |
| InChIKey | BHEJGTJUBBVCBF-RVCACNGLSA-N |
| XLogP | 3.84 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|