C20H28O5S — CID 11211200
[(2R,3S)-2-hydroxy-3-methyl-6-pent-4-enoxyhept-4-ynyl] 4-methylbenzenesulfonate (PubChem CID 11211200) has the molecular formula C20H28O5S and a molecular weight of 380.51 g/mol. Its IUPAC name is [(2R,3S)-2-hydroxy-3-methyl-6-pent-4-enoxyhept-4-ynyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-2-hydroxy-3-methyl-6-pent-4-enoxyhept-4-ynyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11211200 |
| Molecular Formula | C20H28O5S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [(2R,3S)-2-hydroxy-3-methyl-6-pent-4-enoxyhept-4-ynyl] 4-methylbenzenesulfonate |
| SMILES | C=CCCCOC(C)C#C[C@H](C)[C@@H](O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H28O5S/c1-5-6-7-14-24-18(4)11-10-17(3)20(21)15-25-26(22,23)19-12-8-16(2)9-13-19/h5,8-9,12-13,17-18,20-21H,1,6-7,14-15H2,2-4H3/t17-,18?,20-/m0/s1 |
| InChIKey | DZBHBFVKVYQVQX-DXCJPMOASA-N |
| XLogP | 3.07 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|