C15H22O4S — CID 135041566
[(2S,3S)-2-hydroxy-3-methylhept-6-enyl] 4-methylbenzenesulfonate (PubChem CID 135041566) has the molecular formula C15H22O4S and a molecular weight of 298.40 g/mol. Its IUPAC name is [(2S,3S)-2-hydroxy-3-methylhept-6-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S)-2-hydroxy-3-methylhept-6-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135041566 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | [(2S,3S)-2-hydroxy-3-methylhept-6-enyl] 4-methylbenzenesulfonate |
| SMILES | C=CCC[C@H](C)[C@H](O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H22O4S/c1-4-5-6-13(3)15(16)11-19-20(17,18)14-9-7-12(2)8-10-14/h4,7-10,13,15-16H,1,5-6,11H2,2-3H3/t13-,15+/m0/s1 |
| InChIKey | ZARVCAMPUMBDOU-DZGCQCFKSA-N |
| XLogP | 2.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|