C27H27NO8S — CID 131974361
[2-methoxy-5-[(2S)-3-methylidene-4-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 131974361) has the molecular formula C27H27NO8S and a molecular weight of 525.58 g/mol. Its IUPAC name is [2-methoxy-5-[(2S)-3-methylidene-4-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-methoxy-5-[(2S)-3-methylidene-4-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 131974361 |
| Molecular Formula | C27H27NO8S |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | [2-methoxy-5-[(2S)-3-methylidene-4-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | C=C1C(=O)N(c2cc(OC)c(OC)c(OC)c2)[C@H]1c1ccc(OC)c(OS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C27H27NO8S/c1-16-7-10-20(11-8-16)37(30,31)36-22-13-18(9-12-21(22)32-3)25-17(2)27(29)28(25)19-14-23(33-4)26(35-6)24(15-19)34-5/h7-15,25H,2H2,1,3-6H3/t25-/m1/s1 |
| InChIKey | NKIMQIJEJYIEMQ-RUZDIDTESA-N |
| XLogP | 4.44 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|