C20H21NO4 — CID 131974451
(4S)-3-methylidene-4-(4-methylphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one (PubChem CID 131974451) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (4S)-3-methylidene-4-(4-methylphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one.
| Compound Name | (4S)-3-methylidene-4-(4-methylphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 131974451 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (4S)-3-methylidene-4-(4-methylphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
| SMILES | C=C1C(=O)N(c2cc(OC)c(OC)c(OC)c2)[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-12-6-8-14(9-7-12)18-13(2)20(22)21(18)15-10-16(23-3)19(25-5)17(11-15)24-4/h6-11,18H,2H2,1,3-5H3/t18-/m1/s1 |
| InChIKey | XYAUAFSHUCEBCF-GOSISDBHSA-N |
| XLogP | 3.66 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|