C20H20FNO4 — CID 123167280
4-(4-fluorophenyl)-3-methylidene-1-[(3,4,5-trimethoxyphenyl)methyl]azetidin-2-one (PubChem CID 123167280) has the molecular formula C20H20FNO4 and a molecular weight of 357.38 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3-methylidene-1-[(3,4,5-trimethoxyphenyl)methyl]azetidin-2-one.
| Compound Name | 4-(4-fluorophenyl)-3-methylidene-1-[(3,4,5-trimethoxyphenyl)methyl]azetidin-2-one |
|---|---|
| PubChem CID | 123167280 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 4-(4-fluorophenyl)-3-methylidene-1-[(3,4,5-trimethoxyphenyl)methyl]azetidin-2-one |
| SMILES | C=C1C(=O)N(Cc2cc(OC)c(OC)c(OC)c2)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FNO4/c1-12-18(14-5-7-15(21)8-6-14)22(20(12)23)11-13-9-16(24-2)19(26-4)17(10-13)25-3/h5-10,18H,1,11H2,2-4H3 |
| InChIKey | ZQYBNESDINKJPH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|