C24H29NO8S — CID 137456484
[2-methoxy-5-[3-methylidene-4-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] butane-1-sulfonate (PubChem CID 137456484) has the molecular formula C24H29NO8S and a molecular weight of 491.56 g/mol. Its IUPAC name is [2-methoxy-5-[3-methylidene-4-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] butane-1-sulfonate.
| Compound Name | [2-methoxy-5-[3-methylidene-4-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] butane-1-sulfonate |
|---|---|
| PubChem CID | 137456484 |
| Molecular Formula | C24H29NO8S |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | [2-methoxy-5-[3-methylidene-4-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] butane-1-sulfonate |
| SMILES | C=C1C(=O)N(c2cc(OC)c(OC)c(OC)c2)C1c1ccc(OC)c(OS(=O)(=O)CCCC)c1 |
| InChI | InChI=1S/C24H29NO8S/c1-7-8-11-34(27,28)33-19-12-16(9-10-18(19)29-3)22-15(2)24(26)25(22)17-13-20(30-4)23(32-6)21(14-17)31-5/h9-10,12-14,22H,2,7-8,11H2,1,3-6H3 |
| InChIKey | YTIADTSGYUHXCL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|