C24H25NO7 — CID 137456508
[2-methoxy-5-[3-methylidene-4-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] cyclopropanecarboxylate (PubChem CID 137456508) has the molecular formula C24H25NO7 and a molecular weight of 439.46 g/mol. Its IUPAC name is [2-methoxy-5-[3-methylidene-4-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] cyclopropanecarboxylate.
| Compound Name | [2-methoxy-5-[3-methylidene-4-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 137456508 |
| Molecular Formula | C24H25NO7 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [2-methoxy-5-[3-methylidene-4-oxo-1-(3,4,5-trimethoxyphenyl)azetidin-2-yl]phenyl] cyclopropanecarboxylate |
| SMILES | C=C1C(=O)N(c2cc(OC)c(OC)c(OC)c2)C1c1ccc(OC)c(OC(=O)C2CC2)c1 |
| InChI | InChI=1S/C24H25NO7/c1-13-21(15-8-9-17(28-2)18(10-15)32-24(27)14-6-7-14)25(23(13)26)16-11-19(29-3)22(31-5)20(12-16)30-4/h8-12,14,21H,1,6-7H2,2-5H3 |
| InChIKey | HVKDTFJXYIINDT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|