C27H24FNO4 — CID 158497839
[5-[(2S)-1-(3-methoxy-4,5-dimethylphenyl)-3-methylidene-4-oxoazetidin-2-yl]-2-methylphenyl] 4-fluorobenzoate (PubChem CID 158497839) has the molecular formula C27H24FNO4 and a molecular weight of 445.49 g/mol. Its IUPAC name is [5-[(2S)-1-(3-methoxy-4,5-dimethylphenyl)-3-methylidene-4-oxoazetidin-2-yl]-2-methylphenyl] 4-fluorobenzoate.
| Compound Name | [5-[(2S)-1-(3-methoxy-4,5-dimethylphenyl)-3-methylidene-4-oxoazetidin-2-yl]-2-methylphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 158497839 |
| Molecular Formula | C27H24FNO4 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [5-[(2S)-1-(3-methoxy-4,5-dimethylphenyl)-3-methylidene-4-oxoazetidin-2-yl]-2-methylphenyl] 4-fluorobenzoate |
| SMILES | C=C1C(=O)N(c2cc(C)c(C)c(OC)c2)[C@H]1c1ccc(C)c(OC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C27H24FNO4/c1-15-6-7-20(13-23(15)33-27(31)19-8-10-21(28)11-9-19)25-18(4)26(30)29(25)22-12-16(2)17(3)24(14-22)32-5/h6-14,25H,4H2,1-3,5H3/t25-/m1/s1 |
| InChIKey | ZQQVCFYCEZKZPE-RUZDIDTESA-N |
| XLogP | 5.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|