C13H14N2O3S — CID 2306589
(4,6-dimethylpyrimidin-2-yl) 4-methylbenzenesulfonate (PubChem CID 2306589) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is (4,6-dimethylpyrimidin-2-yl) 4-methylbenzenesulfonate.
| Compound Name | (4,6-dimethylpyrimidin-2-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2306589 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (4,6-dimethylpyrimidin-2-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C13H14N2O3S/c1-9-4-6-12(7-5-9)19(16,17)18-13-14-10(2)8-11(3)15-13/h4-8H,1-3H3 |
| InChIKey | GGUZEMARZNPMSG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|