C20H19NO7S — CID 168540888
[2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl] 4-methylbenzenesulfonate (PubChem CID 168540888) has the molecular formula C20H19NO7S and a molecular weight of 417.44 g/mol. Its IUPAC name is [2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 168540888 |
| Molecular Formula | C20H19NO7S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [2-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2NC=C2C(=O)OC(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C20H19NO7S/c1-13-8-10-14(11-9-13)29(24,25)28-17-7-5-4-6-16(17)21-12-15-18(22)26-20(2,3)27-19(15)23/h4-12,21H,1-3H3 |
| InChIKey | KYISLRZHIMWVOV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|