C20H18O6S — CID 168599167
2,2-dimethyl-5-[[2-(4-methylphenyl)sulfonylphenyl]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168599167) has the molecular formula C20H18O6S and a molecular weight of 386.43 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[2-(4-methylphenyl)sulfonylphenyl]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[2-(4-methylphenyl)sulfonylphenyl]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168599167 |
| Molecular Formula | C20H18O6S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2,2-dimethyl-5-[[2-(4-methylphenyl)sulfonylphenyl]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | Cc1ccc(S(=O)(=O)c2ccccc2C=C2C(=O)OC(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C20H18O6S/c1-13-8-10-15(11-9-13)27(23,24)17-7-5-4-6-14(17)12-16-18(21)25-20(2,3)26-19(16)22/h4-12H,1-3H3 |
| InChIKey | NNXWSELFSKRQIT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|