C27H24O6S3 — CID 18699518
1,2,3-tris-(4-methylphenyl)sulfonylbenzene (PubChem CID 18699518) has the molecular formula C27H24O6S3 and a molecular weight of 540.68 g/mol. Its IUPAC name is 1,2,3-tris-(4-methylphenyl)sulfonylbenzene.
| Compound Name | 1,2,3-tris-(4-methylphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 18699518 |
| Molecular Formula | C27H24O6S3 |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | 1,2,3-tris-(4-methylphenyl)sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)c2cccc(S(=O)(=O)c3ccc(C)cc3)c2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H24O6S3/c1-19-7-13-22(14-8-19)34(28,29)25-5-4-6-26(35(30,31)23-15-9-20(2)10-16-23)27(25)36(32,33)24-17-11-21(3)12-18-24/h4-18H,1-3H3 |
| InChIKey | CVUQWRQOSWSBNR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |