C20H18O7S — CID 168600452
5-[[2-(benzenesulfonyl)-4-methoxyphenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168600452) has the molecular formula C20H18O7S and a molecular weight of 402.42 g/mol. Its IUPAC name is 5-[[2-(benzenesulfonyl)-4-methoxyphenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[2-(benzenesulfonyl)-4-methoxyphenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168600452 |
| Molecular Formula | C20H18O7S |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 5-[[2-(benzenesulfonyl)-4-methoxyphenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1ccc(C=C2C(=O)OC(C)(C)OC2=O)c(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H18O7S/c1-20(2)26-18(21)16(19(22)27-20)11-13-9-10-14(25-3)12-17(13)28(23,24)15-7-5-4-6-8-15/h4-12H,1-3H3 |
| InChIKey | KWQVUQCVCBBHRT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|