C28H26N2O7S2 — CID 142536816
[2-[[2-(4-ethylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 4-methylbenzenesulfonate (PubChem CID 142536816) has the molecular formula C28H26N2O7S2 and a molecular weight of 566.66 g/mol. Its IUPAC name is [2-[[2-(4-ethylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[[2-(4-ethylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 142536816 |
| Molecular Formula | C28H26N2O7S2 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | [2-[[2-(4-ethylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 4-methylbenzenesulfonate |
| SMILES | CCc1ccc(S(=O)(=O)Oc2ccccc2NC(=O)Nc2ccccc2OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H26N2O7S2/c1-3-21-14-18-23(19-15-21)39(34,35)37-27-11-7-5-9-25(27)30-28(31)29-24-8-4-6-10-26(24)36-38(32,33)22-16-12-20(2)13-17-22/h4-19H,3H2,1-2H3,(H2,29,30,31) |
| InChIKey | VBYPFIUMRUGORY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|