C23H24N2O7S2 — CID 142536531
[2-[(2-benzylsulfonyloxyphenyl)carbamoylamino]phenyl] propane-1-sulfonate (PubChem CID 142536531) has the molecular formula C23H24N2O7S2 and a molecular weight of 504.59 g/mol. Its IUPAC name is [2-[(2-benzylsulfonyloxyphenyl)carbamoylamino]phenyl] propane-1-sulfonate.
| Compound Name | [2-[(2-benzylsulfonyloxyphenyl)carbamoylamino]phenyl] propane-1-sulfonate |
|---|---|
| PubChem CID | 142536531 |
| Molecular Formula | C23H24N2O7S2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | [2-[(2-benzylsulfonyloxyphenyl)carbamoylamino]phenyl] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)Oc1ccccc1NC(=O)Nc1ccccc1OS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H24N2O7S2/c1-2-16-33(27,28)31-21-14-8-6-12-19(21)24-23(26)25-20-13-7-9-15-22(20)32-34(29,30)17-18-10-4-3-5-11-18/h3-15H,2,16-17H2,1H3,(H2,24,25,26) |
| InChIKey | CDAZGFPZWXIBKR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|