C26H22N2O6S — CID 168860582
methyl 2-benzylsulfonyloxy-5-(naphthalen-1-ylcarbamoylamino)benzoate (PubChem CID 168860582) has the molecular formula C26H22N2O6S and a molecular weight of 490.54 g/mol. Its IUPAC name is methyl 2-benzylsulfonyloxy-5-(naphthalen-1-ylcarbamoylamino)benzoate.
| Compound Name | methyl 2-benzylsulfonyloxy-5-(naphthalen-1-ylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 168860582 |
| Molecular Formula | C26H22N2O6S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | methyl 2-benzylsulfonyloxy-5-(naphthalen-1-ylcarbamoylamino)benzoate |
| SMILES | COC(=O)c1cc(NC(=O)Nc2cccc3ccccc23)ccc1OS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C26H22N2O6S/c1-33-25(29)22-16-20(14-15-24(22)34-35(31,32)17-18-8-3-2-4-9-18)27-26(30)28-23-13-7-11-19-10-5-6-12-21(19)23/h2-16H,17H2,1H3,(H2,27,28,30) |
| InChIKey | XHKYZKCERWYAPG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|