C27H24N2O7S2 — CID 142536542
[3-[[2-(benzenesulfonyloxy)phenyl]carbamoylamino]phenyl] 4-ethylbenzenesulfonate (PubChem CID 142536542) has the molecular formula C27H24N2O7S2 and a molecular weight of 552.63 g/mol. Its IUPAC name is [3-[[2-(benzenesulfonyloxy)phenyl]carbamoylamino]phenyl] 4-ethylbenzenesulfonate.
| Compound Name | [3-[[2-(benzenesulfonyloxy)phenyl]carbamoylamino]phenyl] 4-ethylbenzenesulfonate |
|---|---|
| PubChem CID | 142536542 |
| Molecular Formula | C27H24N2O7S2 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | [3-[[2-(benzenesulfonyloxy)phenyl]carbamoylamino]phenyl] 4-ethylbenzenesulfonate |
| SMILES | CCc1ccc(S(=O)(=O)Oc2cccc(NC(=O)Nc3ccccc3OS(=O)(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H24N2O7S2/c1-2-20-15-17-24(18-16-20)37(31,32)35-22-10-8-9-21(19-22)28-27(30)29-25-13-6-7-14-26(25)36-38(33,34)23-11-4-3-5-12-23/h3-19H,2H2,1H3,(H2,28,29,30) |
| InChIKey | YCACOTAXGSNMRC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|