C37H28N2O7S2 — CID 142536668
[3-[[2-(2-phenylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 2-phenylbenzenesulfonate (PubChem CID 142536668) has the molecular formula C37H28N2O7S2 and a molecular weight of 676.77 g/mol. Its IUPAC name is [3-[[2-(2-phenylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 2-phenylbenzenesulfonate.
| Compound Name | [3-[[2-(2-phenylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 2-phenylbenzenesulfonate |
|---|---|
| PubChem CID | 142536668 |
| Molecular Formula | C37H28N2O7S2 |
| Molecular Weight | 676.77 g/mol |
| Exact Mass | 676.13 |
| IUPAC Name | [3-[[2-(2-phenylphenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] 2-phenylbenzenesulfonate |
| SMILES | O=C(Nc1cccc(OS(=O)(=O)c2ccccc2-c2ccccc2)c1)Nc1ccccc1OS(=O)(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C37H28N2O7S2/c40-37(38-29-18-13-19-30(26-29)45-47(41,42)35-24-11-7-20-31(35)27-14-3-1-4-15-27)39-33-22-9-10-23-34(33)46-48(43,44)36-25-12-8-21-32(36)28-16-5-2-6-17-28/h1-26H,(H2,38,39,40) |
| InChIKey | DMNQJVLGRDZJMQ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.77 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|