C41H32N4O8S2 — CID 155661475
[3-[[2-methyl-3-[(3-naphthalen-1-ylsulfonyloxyphenyl)carbamoylamino]phenyl]carbamoylamino]phenyl] naphthalene-1-sulfonate (PubChem CID 155661475) has the molecular formula C41H32N4O8S2 and a molecular weight of 772.86 g/mol. Its IUPAC name is [3-[[2-methyl-3-[(3-naphthalen-1-ylsulfonyloxyphenyl)carbamoylamino]phenyl]carbamoylamino]phenyl] naphthalene-1-sulfonate.
| Compound Name | [3-[[2-methyl-3-[(3-naphthalen-1-ylsulfonyloxyphenyl)carbamoylamino]phenyl]carbamoylamino]phenyl] naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 155661475 |
| Molecular Formula | C41H32N4O8S2 |
| Molecular Weight | 772.86 g/mol |
| Exact Mass | 772.17 |
| IUPAC Name | [3-[[2-methyl-3-[(3-naphthalen-1-ylsulfonyloxyphenyl)carbamoylamino]phenyl]carbamoylamino]phenyl] naphthalene-1-sulfonate |
| SMILES | Cc1c(NC(=O)Nc2cccc(OS(=O)(=O)c3cccc4ccccc34)c2)cccc1NC(=O)Nc1cccc(OS(=O)(=O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C41H32N4O8S2/c1-27-36(44-40(46)42-30-15-8-17-32(25-30)52-54(48,49)38-23-6-13-28-11-2-4-19-34(28)38)21-10-22-37(27)45-41(47)43-31-16-9-18-33(26-31)53-55(50,51)39-24-7-14-29-12-3-5-20-35(29)39/h2-26H,1H3,(H2,42,44,46)(H2,43,45,47) |
| InChIKey | UDEUYRNIAGHQDO-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.86 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|