C21H20N2O5S — CID 150762538
[3-[(4-hydroxyphenyl)carbamoylamino]phenyl] 2,5-dimethylbenzenesulfonate (PubChem CID 150762538) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is [3-[(4-hydroxyphenyl)carbamoylamino]phenyl] 2,5-dimethylbenzenesulfonate.
| Compound Name | [3-[(4-hydroxyphenyl)carbamoylamino]phenyl] 2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 150762538 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [3-[(4-hydroxyphenyl)carbamoylamino]phenyl] 2,5-dimethylbenzenesulfonate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Oc2cccc(NC(=O)Nc3ccc(O)cc3)c2)c1 |
| InChI | InChI=1S/C21H20N2O5S/c1-14-6-7-15(2)20(12-14)29(26,27)28-19-5-3-4-17(13-19)23-21(25)22-16-8-10-18(24)11-9-16/h3-13,24H,1-2H3,(H2,22,23,25) |
| InChIKey | JYDFKPNCESSYBH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|