C50H44N6O12S2 — CID 155714852
bis[3-[[2-methyl-5-[(4-methylphenoxy)carbonylamino]phenyl]carbamoylamino]phenyl] benzene-1,3-disulfonate (PubChem CID 155714852) has the molecular formula C50H44N6O12S2 and a molecular weight of 985.07 g/mol. Its IUPAC name is bis[3-[[2-methyl-5-[(4-methylphenoxy)carbonylamino]phenyl]carbamoylamino]phenyl] benzene-1,3-disulfonate.
| Compound Name | bis[3-[[2-methyl-5-[(4-methylphenoxy)carbonylamino]phenyl]carbamoylamino]phenyl] benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 155714852 |
| Molecular Formula | C50H44N6O12S2 |
| Molecular Weight | 985.07 g/mol |
| Exact Mass | 984.25 |
| IUPAC Name | bis[3-[[2-methyl-5-[(4-methylphenoxy)carbonylamino]phenyl]carbamoylamino]phenyl] benzene-1,3-disulfonate |
| SMILES | Cc1ccc(OC(=O)Nc2ccc(C)c(NC(=O)Nc3cccc(OS(=O)(=O)c4cccc(S(=O)(=O)Oc5cccc(NC(=O)Nc6cc(NC(=O)Oc7ccc(C)cc7)ccc6C)c5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C50H44N6O12S2/c1-31-14-22-39(23-15-31)65-49(59)53-37-20-18-33(3)45(28-37)55-47(57)51-35-8-5-10-41(26-35)67-69(61,62)43-12-7-13-44(30-43)70(63,64)68-42-11-6-9-36(27-42)52-48(58)56-46-29-38(21-19-34(46)4)54-50(60)66-40-24-16-32(2)17-25-40/h5-30H,1-4H3,(H,53,59)(H,54,60)(H2,51,55,57)(H2,52,56,58) |
| InChIKey | HXDIECHJANVNDM-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 245.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.07 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|