C21H19N3O5S — CID 156630505
(4-methylphenyl) 3-(phenylcarbamoylcarbamoylamino)benzenesulfonate (PubChem CID 156630505) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is (4-methylphenyl) 3-(phenylcarbamoylcarbamoylamino)benzenesulfonate.
| Compound Name | (4-methylphenyl) 3-(phenylcarbamoylcarbamoylamino)benzenesulfonate |
|---|---|
| PubChem CID | 156630505 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | (4-methylphenyl) 3-(phenylcarbamoylcarbamoylamino)benzenesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)c2cccc(NC(=O)NC(=O)Nc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C21H19N3O5S/c1-15-10-12-18(13-11-15)29-30(27,28)19-9-5-8-17(14-19)23-21(26)24-20(25)22-16-6-3-2-4-7-16/h2-14H,1H3,(H3,22,23,24,25,26) |
| InChIKey | MTJDAZACZRMOOV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|