C23H21N3O6S — CID 156630507
(4-methylphenyl) 4-[(4-acetylphenyl)carbamoylcarbamoylamino]benzenesulfonate (PubChem CID 156630507) has the molecular formula C23H21N3O6S and a molecular weight of 467.50 g/mol. Its IUPAC name is (4-methylphenyl) 4-[(4-acetylphenyl)carbamoylcarbamoylamino]benzenesulfonate.
| Compound Name | (4-methylphenyl) 4-[(4-acetylphenyl)carbamoylcarbamoylamino]benzenesulfonate |
|---|---|
| PubChem CID | 156630507 |
| Molecular Formula | C23H21N3O6S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (4-methylphenyl) 4-[(4-acetylphenyl)carbamoylcarbamoylamino]benzenesulfonate |
| SMILES | CC(=O)c1ccc(NC(=O)NC(=O)Nc2ccc(S(=O)(=O)Oc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C23H21N3O6S/c1-15-3-11-20(12-4-15)32-33(30,31)21-13-9-19(10-14-21)25-23(29)26-22(28)24-18-7-5-17(6-8-18)16(2)27/h3-14H,1-2H3,(H3,24,25,26,28,29) |
| InChIKey | ZXDKSYKYOGFUOU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|