C28H26N4O8S2 — CID 155661523
[3-[[4-[4-[(3-methylsulfonyloxyphenyl)carbamoylamino]phenyl]phenyl]carbamoylamino]phenyl] methanesulfonate (PubChem CID 155661523) has the molecular formula C28H26N4O8S2 and a molecular weight of 610.67 g/mol. Its IUPAC name is [3-[[4-[4-[(3-methylsulfonyloxyphenyl)carbamoylamino]phenyl]phenyl]carbamoylamino]phenyl] methanesulfonate.
| Compound Name | [3-[[4-[4-[(3-methylsulfonyloxyphenyl)carbamoylamino]phenyl]phenyl]carbamoylamino]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 155661523 |
| Molecular Formula | C28H26N4O8S2 |
| Molecular Weight | 610.67 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | [3-[[4-[4-[(3-methylsulfonyloxyphenyl)carbamoylamino]phenyl]phenyl]carbamoylamino]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1cccc(NC(=O)Nc2ccc(-c3ccc(NC(=O)Nc4cccc(OS(C)(=O)=O)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C28H26N4O8S2/c1-41(35,36)39-25-7-3-5-23(17-25)31-27(33)29-21-13-9-19(10-14-21)20-11-15-22(16-12-20)30-28(34)32-24-6-4-8-26(18-24)40-42(2,37)38/h3-18H,1-2H3,(H2,29,31,33)(H2,30,32,34) |
| InChIKey | NLRMTEKANPHSNM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|