C32H30N4O12S2 — CID 155659611
bis[3-[(3-methylsulfonyloxyphenyl)carbamoylamino]phenyl] butanedioate (PubChem CID 155659611) has the molecular formula C32H30N4O12S2 and a molecular weight of 726.74 g/mol. Its IUPAC name is bis[3-[(3-methylsulfonyloxyphenyl)carbamoylamino]phenyl] butanedioate.
| Compound Name | bis[3-[(3-methylsulfonyloxyphenyl)carbamoylamino]phenyl] butanedioate |
|---|---|
| PubChem CID | 155659611 |
| Molecular Formula | C32H30N4O12S2 |
| Molecular Weight | 726.74 g/mol |
| Exact Mass | 726.13 |
| IUPAC Name | bis[3-[(3-methylsulfonyloxyphenyl)carbamoylamino]phenyl] butanedioate |
| SMILES | CS(=O)(=O)Oc1cccc(NC(=O)Nc2cccc(OC(=O)CCC(=O)Oc3cccc(NC(=O)Nc4cccc(OS(C)(=O)=O)c4)c3)c2)c1 |
| InChI | InChI=1S/C32H30N4O12S2/c1-49(41,42)47-27-13-5-9-23(19-27)35-31(39)33-21-7-3-11-25(17-21)45-29(37)15-16-30(38)46-26-12-4-8-22(18-26)34-32(40)36-24-10-6-14-28(20-24)48-50(2,43)44/h3-14,17-20H,15-16H2,1-2H3,(H2,33,35,39)(H2,34,36,40) |
| InChIKey | GDZGWBQIVHOGFY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 221.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.74 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|