C32H24Cl2N4O8S2 — CID 155661518
[3-[[3-[[3-(4-chlorophenyl)sulfonyloxyphenyl]carbamoylamino]phenyl]carbamoylamino]phenyl] 4-chlorobenzenesulfonate (PubChem CID 155661518) has the molecular formula C32H24Cl2N4O8S2 and a molecular weight of 727.60 g/mol. Its IUPAC name is [3-[[3-[[3-(4-chlorophenyl)sulfonyloxyphenyl]carbamoylamino]phenyl]carbamoylamino]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [3-[[3-[[3-(4-chlorophenyl)sulfonyloxyphenyl]carbamoylamino]phenyl]carbamoylamino]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 155661518 |
| Molecular Formula | C32H24Cl2N4O8S2 |
| Molecular Weight | 727.60 g/mol |
| Exact Mass | 726.04 |
| IUPAC Name | [3-[[3-[[3-(4-chlorophenyl)sulfonyloxyphenyl]carbamoylamino]phenyl]carbamoylamino]phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=C(Nc1cccc(NC(=O)Nc2cccc(OS(=O)(=O)c3ccc(Cl)cc3)c2)c1)Nc1cccc(OS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C32H24Cl2N4O8S2/c33-21-10-14-29(15-11-21)47(41,42)45-27-8-2-6-25(19-27)37-31(39)35-23-4-1-5-24(18-23)36-32(40)38-26-7-3-9-28(20-26)46-48(43,44)30-16-12-22(34)13-17-30/h1-20H,(H2,35,37,39)(H2,36,38,40) |
| InChIKey | LYMCKNAKEIYSAB-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.60 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|