C40H34N4O6S2 — CID 155244317
[3-[(3-methylphenyl)carbamoylamino]phenyl] 4-[4-[3-[(3-methylphenyl)carbamoylamino]phenoxy]sulfanylphenyl]benzenesulfonate (PubChem CID 155244317) has the molecular formula C40H34N4O6S2 and a molecular weight of 730.87 g/mol. Its IUPAC name is [3-[(3-methylphenyl)carbamoylamino]phenyl] 4-[4-[3-[(3-methylphenyl)carbamoylamino]phenoxy]sulfanylphenyl]benzenesulfonate.
| Compound Name | [3-[(3-methylphenyl)carbamoylamino]phenyl] 4-[4-[3-[(3-methylphenyl)carbamoylamino]phenoxy]sulfanylphenyl]benzenesulfonate |
|---|---|
| PubChem CID | 155244317 |
| Molecular Formula | C40H34N4O6S2 |
| Molecular Weight | 730.87 g/mol |
| Exact Mass | 730.19 |
| IUPAC Name | [3-[(3-methylphenyl)carbamoylamino]phenyl] 4-[4-[3-[(3-methylphenyl)carbamoylamino]phenoxy]sulfanylphenyl]benzenesulfonate |
| SMILES | Cc1cccc(NC(=O)Nc2cccc(OSc3ccc(-c4ccc(S(=O)(=O)Oc5cccc(NC(=O)Nc6cccc(C)c6)c5)cc4)cc3)c2)c1 |
| InChI | InChI=1S/C40H34N4O6S2/c1-27-7-3-9-31(23-27)41-39(45)43-33-11-5-13-35(25-33)49-51-37-19-15-29(16-20-37)30-17-21-38(22-18-30)52(47,48)50-36-14-6-12-34(26-36)44-40(46)42-32-10-4-8-28(2)24-32/h3-26H,1-2H3,(H2,41,43,45)(H2,42,44,46) |
| InChIKey | OMMNQXLPKUEYBD-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.87 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|