C19H20N4O6 — CID 53027824
N-(2,4-dimethoxyphenyl)-1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 53027824) has the molecular formula C19H20N4O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 53027824 |
| Molecular Formula | C19H20N4O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(=O)n(C)c3c2c(=O)n(C)c(=O)n3C)c(OC)c1 |
| InChI | InChI=1S/C19H20N4O6/c1-21-14(24)9-11(15-17(21)22(2)19(27)23(3)18(15)26)16(25)20-12-7-6-10(28-4)8-13(12)29-5/h6-9H,1-5H3,(H,20,25) |
| InChIKey | BCIXSCVHLJWSAO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |