C24H18F3N3O7S — CID 123461348
ethyl 7-oxo-4-phenyl-8-phenylmethoxy-5-(trifluoromethylsulfonyloxy)pyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 123461348) has the molecular formula C24H18F3N3O7S and a molecular weight of 549.48 g/mol. Its IUPAC name is ethyl 7-oxo-4-phenyl-8-phenylmethoxy-5-(trifluoromethylsulfonyloxy)pyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-oxo-4-phenyl-8-phenylmethoxy-5-(trifluoromethylsulfonyloxy)pyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 123461348 |
| Molecular Formula | C24H18F3N3O7S |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | ethyl 7-oxo-4-phenyl-8-phenylmethoxy-5-(trifluoromethylsulfonyloxy)pyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1c(OS(=O)(=O)C(F)(F)F)c2c(-c3ccccc3)ncnc2n(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C24H18F3N3O7S/c1-2-35-23(32)18-20(37-38(33,34)24(25,26)27)17-19(16-11-7-4-8-12-16)28-14-29-21(17)30(22(18)31)36-13-15-9-5-3-6-10-15/h3-12,14H,2,13H2,1H3 |
| InChIKey | XJCWSJMPOXXESY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 126.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|