C17H12F3N3O7S — CID 150187140
2-methyl-7-oxo-8-phenylmethoxy-5-(trifluoromethylsulfonyloxy)pyrido[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 150187140) has the molecular formula C17H12F3N3O7S and a molecular weight of 459.36 g/mol. Its IUPAC name is 2-methyl-7-oxo-8-phenylmethoxy-5-(trifluoromethylsulfonyloxy)pyrido[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 2-methyl-7-oxo-8-phenylmethoxy-5-(trifluoromethylsulfonyloxy)pyrido[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 150187140 |
| Molecular Formula | C17H12F3N3O7S |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | 2-methyl-7-oxo-8-phenylmethoxy-5-(trifluoromethylsulfonyloxy)pyrido[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | Cc1ncc2c(OS(=O)(=O)C(F)(F)F)c(C(=O)O)c(=O)n(OCc3ccccc3)c2n1 |
| InChI | InChI=1S/C17H12F3N3O7S/c1-9-21-7-11-13(30-31(27,28)17(18,19)20)12(16(25)26)15(24)23(14(11)22-9)29-8-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,25,26) |
| InChIKey | FMQWOUHWOVHXOG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|