C26H24F4N2O6S — CID 118431037
[5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-3-methyl-2-oxo-1-phenylmethoxy-4-pyridinyl] trifluoromethanesulfonate (PubChem CID 118431037) has the molecular formula C26H24F4N2O6S and a molecular weight of 568.55 g/mol. Its IUPAC name is [5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-3-methyl-2-oxo-1-phenylmethoxy-4-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-3-methyl-2-oxo-1-phenylmethoxy-4-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118431037 |
| Molecular Formula | C26H24F4N2O6S |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | [5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-3-methyl-2-oxo-1-phenylmethoxy-4-pyridinyl] trifluoromethanesulfonate |
| SMILES | Cc1c(OS(=O)(=O)C(F)(F)F)c(C(=O)N2CCC(c3ccc(F)cc3)CC2)cn(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C26H24F4N2O6S/c1-17-23(38-39(35,36)26(28,29)30)22(15-32(24(17)33)37-16-18-5-3-2-4-6-18)25(34)31-13-11-20(12-14-31)19-7-9-21(27)10-8-19/h2-10,15,20H,11-14,16H2,1H3 |
| InChIKey | FGPWMBNIQBUAMU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|