C24H24FN3O4S — CID 174770341
(4-anilino-3-methyl-2-pyridinyl)sulfonyl 4-(4-fluorophenyl)piperidine-1-carboxylate (PubChem CID 174770341) has the molecular formula C24H24FN3O4S and a molecular weight of 469.54 g/mol. Its IUPAC name is (4-anilino-3-methyl-2-pyridinyl)sulfonyl 4-(4-fluorophenyl)piperidine-1-carboxylate.
| Compound Name | (4-anilino-3-methyl-2-pyridinyl)sulfonyl 4-(4-fluorophenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174770341 |
| Molecular Formula | C24H24FN3O4S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | (4-anilino-3-methyl-2-pyridinyl)sulfonyl 4-(4-fluorophenyl)piperidine-1-carboxylate |
| SMILES | Cc1c(Nc2ccccc2)ccnc1S(=O)(=O)OC(=O)N1CCC(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H24FN3O4S/c1-17-22(27-21-5-3-2-4-6-21)11-14-26-23(17)33(30,31)32-24(29)28-15-12-19(13-16-28)18-7-9-20(25)10-8-18/h2-11,14,19H,12-13,15-16H2,1H3,(H,26,27) |
| InChIKey | BYFGAFVXEDHLSN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|