C24H22F3N3O4S — CID 118412792
4-(2,5-difluoroanilino)-5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-3-methylpyridine-2-sulfonic acid (PubChem CID 118412792) has the molecular formula C24H22F3N3O4S and a molecular weight of 505.52 g/mol. Its IUPAC name is 4-(2,5-difluoroanilino)-5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-3-methylpyridine-2-sulfonic acid.
| Compound Name | 4-(2,5-difluoroanilino)-5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-3-methylpyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 118412792 |
| Molecular Formula | C24H22F3N3O4S |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 4-(2,5-difluoroanilino)-5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-3-methylpyridine-2-sulfonic acid |
| SMILES | Cc1c(S(=O)(=O)O)ncc(C(=O)N2CCC(c3ccc(F)cc3)CC2)c1Nc1cc(F)ccc1F |
| InChI | InChI=1S/C24H22F3N3O4S/c1-14-22(29-21-12-18(26)6-7-20(21)27)19(13-28-23(14)35(32,33)34)24(31)30-10-8-16(9-11-30)15-2-4-17(25)5-3-15/h2-7,12-13,16H,8-11H2,1H3,(H,28,29)(H,32,33,34) |
| InChIKey | GRXIMCJRXAUKPU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|