C24H23ClFN5O5S — CID 118412635
3-chloro-5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-4-(2-methyl-4-nitroanilino)pyridine-2-sulfonamide (PubChem CID 118412635) has the molecular formula C24H23ClFN5O5S and a molecular weight of 548.00 g/mol. Its IUPAC name is 3-chloro-5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-4-(2-methyl-4-nitroanilino)pyridine-2-sulfonamide.
| Compound Name | 3-chloro-5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-4-(2-methyl-4-nitroanilino)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 118412635 |
| Molecular Formula | C24H23ClFN5O5S |
| Molecular Weight | 548.00 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | 3-chloro-5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-4-(2-methyl-4-nitroanilino)pyridine-2-sulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1Nc1c(C(=O)N2CCC(c3ccc(F)cc3)CC2)cnc(S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C24H23ClFN5O5S/c1-14-12-18(31(33)34)6-7-20(14)29-22-19(13-28-23(21(22)25)37(27,35)36)24(32)30-10-8-16(9-11-30)15-2-4-17(26)5-3-15/h2-7,12-13,16H,8-11H2,1H3,(H,28,29)(H2,27,35,36) |
| InChIKey | VBNKJBYTSGQCTN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 148.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.00 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|