C24H25FN4O3S — CID 118412514
4-(4-fluoro-2-methylanilino)-5-(4-phenylpiperidine-1-carbonyl)pyridine-2-sulfonamide (PubChem CID 118412514) has the molecular formula C24H25FN4O3S and a molecular weight of 468.55 g/mol. Its IUPAC name is 4-(4-fluoro-2-methylanilino)-5-(4-phenylpiperidine-1-carbonyl)pyridine-2-sulfonamide.
| Compound Name | 4-(4-fluoro-2-methylanilino)-5-(4-phenylpiperidine-1-carbonyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 118412514 |
| Molecular Formula | C24H25FN4O3S |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 4-(4-fluoro-2-methylanilino)-5-(4-phenylpiperidine-1-carbonyl)pyridine-2-sulfonamide |
| SMILES | Cc1cc(F)ccc1Nc1cc(S(N)(=O)=O)ncc1C(=O)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H25FN4O3S/c1-16-13-19(25)7-8-21(16)28-22-14-23(33(26,31)32)27-15-20(22)24(30)29-11-9-18(10-12-29)17-5-3-2-4-6-17/h2-8,13-15,18H,9-12H2,1H3,(H,27,28)(H2,26,31,32) |
| InChIKey | KVKDRZIWMBYOCI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |