C24H23ClFN3OS — CID 118412613
[4-(4-chloro-2-methylanilino)-6-sulfanylidene-1H-pyridin-3-yl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone (PubChem CID 118412613) has the molecular formula C24H23ClFN3OS and a molecular weight of 455.99 g/mol. Its IUPAC name is [4-(4-chloro-2-methylanilino)-6-sulfanylidene-1H-pyridin-3-yl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone.
| Compound Name | [4-(4-chloro-2-methylanilino)-6-sulfanylidene-1H-pyridin-3-yl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 118412613 |
| Molecular Formula | C24H23ClFN3OS |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | [4-(4-chloro-2-methylanilino)-6-sulfanylidene-1H-pyridin-3-yl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone |
| SMILES | Cc1cc(Cl)ccc1Nc1cc(=S)[nH]cc1C(=O)N1CCC(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H23ClFN3OS/c1-15-12-18(25)4-7-21(15)28-22-13-23(31)27-14-20(22)24(30)29-10-8-17(9-11-29)16-2-5-19(26)6-3-16/h2-7,12-14,17H,8-11H2,1H3,(H2,27,28,31) |
| InChIKey | UIKCFKMGYNEVFT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|