C24H21Cl2F2N3O — CID 118412217
[6-chloro-4-(2-chloro-5-fluoroanilino)-5-methyl-3-pyridinyl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone (PubChem CID 118412217) has the molecular formula C24H21Cl2F2N3O and a molecular weight of 476.35 g/mol. Its IUPAC name is [6-chloro-4-(2-chloro-5-fluoroanilino)-5-methyl-3-pyridinyl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone.
| Compound Name | [6-chloro-4-(2-chloro-5-fluoroanilino)-5-methyl-3-pyridinyl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 118412217 |
| Molecular Formula | C24H21Cl2F2N3O |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | [6-chloro-4-(2-chloro-5-fluoroanilino)-5-methyl-3-pyridinyl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone |
| SMILES | Cc1c(Cl)ncc(C(=O)N2CCC(c3ccc(F)cc3)CC2)c1Nc1cc(F)ccc1Cl |
| InChI | InChI=1S/C24H21Cl2F2N3O/c1-14-22(30-21-12-18(28)6-7-20(21)25)19(13-29-23(14)26)24(32)31-10-8-16(9-11-31)15-2-4-17(27)5-3-15/h2-7,12-13,16H,8-11H2,1H3,(H,29,30) |
| InChIKey | JTYJFJIFYLEMCU-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|