C24H22ClF2N3O — CID 118412730
[6-chloro-4-(3-fluoroanilino)-5-methyl-3-pyridinyl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone (PubChem CID 118412730) has the molecular formula C24H22ClF2N3O and a molecular weight of 441.91 g/mol. Its IUPAC name is [6-chloro-4-(3-fluoroanilino)-5-methyl-3-pyridinyl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone.
| Compound Name | [6-chloro-4-(3-fluoroanilino)-5-methyl-3-pyridinyl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 118412730 |
| Molecular Formula | C24H22ClF2N3O |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | [6-chloro-4-(3-fluoroanilino)-5-methyl-3-pyridinyl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone |
| SMILES | Cc1c(Cl)ncc(C(=O)N2CCC(c3ccc(F)cc3)CC2)c1Nc1cccc(F)c1 |
| InChI | InChI=1S/C24H22ClF2N3O/c1-15-22(29-20-4-2-3-19(27)13-20)21(14-28-23(15)25)24(31)30-11-9-17(10-12-30)16-5-7-18(26)8-6-16/h2-8,13-14,17H,9-12H2,1H3,(H,28,29) |
| InChIKey | XCFDJPYAHQCYDK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|