C25H26FN3O4S — CID 118412574
5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-3-methyl-4-(3-methylanilino)pyridine-2-sulfonic acid (PubChem CID 118412574) has the molecular formula C25H26FN3O4S and a molecular weight of 483.57 g/mol. Its IUPAC name is 5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-3-methyl-4-(3-methylanilino)pyridine-2-sulfonic acid.
| Compound Name | 5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-3-methyl-4-(3-methylanilino)pyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 118412574 |
| Molecular Formula | C25H26FN3O4S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 5-[4-(4-fluorophenyl)piperidine-1-carbonyl]-3-methyl-4-(3-methylanilino)pyridine-2-sulfonic acid |
| SMILES | Cc1cccc(Nc2c(C(=O)N3CCC(c4ccc(F)cc4)CC3)cnc(S(=O)(=O)O)c2C)c1 |
| InChI | InChI=1S/C25H26FN3O4S/c1-16-4-3-5-21(14-16)28-23-17(2)24(34(31,32)33)27-15-22(23)25(30)29-12-10-19(11-13-29)18-6-8-20(26)9-7-18/h3-9,14-15,19H,10-13H2,1-2H3,(H,27,28)(H,31,32,33) |
| InChIKey | OTSZPTTXZAMWRO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|