C26H22ClFN4O — CID 118412572
[6-chloro-4-(quinolin-6-ylamino)-3-pyridinyl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone (PubChem CID 118412572) has the molecular formula C26H22ClFN4O and a molecular weight of 460.94 g/mol. Its IUPAC name is [6-chloro-4-(quinolin-6-ylamino)-3-pyridinyl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone.
| Compound Name | [6-chloro-4-(quinolin-6-ylamino)-3-pyridinyl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 118412572 |
| Molecular Formula | C26H22ClFN4O |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [6-chloro-4-(quinolin-6-ylamino)-3-pyridinyl]-[4-(4-fluorophenyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cnc(Cl)cc1Nc1ccc2ncccc2c1)N1CCC(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H22ClFN4O/c27-25-15-24(31-21-7-8-23-19(14-21)2-1-11-29-23)22(16-30-25)26(33)32-12-9-18(10-13-32)17-3-5-20(28)6-4-17/h1-8,11,14-16,18H,9-10,12-13H2,(H,30,31) |
| InChIKey | GEBQOPBKMQOJIF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|