C29H26FN3O4S — CID 171678356
N-[4-[1-(3-fluoro-4-methylsulfonylbenzoyl)piperidin-4-yl]phenyl]quinoline-6-carboxamide (PubChem CID 171678356) has the molecular formula C29H26FN3O4S and a molecular weight of 531.61 g/mol. Its IUPAC name is N-[4-[1-(3-fluoro-4-methylsulfonylbenzoyl)piperidin-4-yl]phenyl]quinoline-6-carboxamide.
| Compound Name | N-[4-[1-(3-fluoro-4-methylsulfonylbenzoyl)piperidin-4-yl]phenyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 171678356 |
| Molecular Formula | C29H26FN3O4S |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | N-[4-[1-(3-fluoro-4-methylsulfonylbenzoyl)piperidin-4-yl]phenyl]quinoline-6-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N2CCC(c3ccc(NC(=O)c4ccc5ncccc5c4)cc3)CC2)cc1F |
| InChI | InChI=1S/C29H26FN3O4S/c1-38(36,37)27-11-7-23(18-25(27)30)29(35)33-15-12-20(13-16-33)19-4-8-24(9-5-19)32-28(34)22-6-10-26-21(17-22)3-2-14-31-26/h2-11,14,17-18,20H,12-13,15-16H2,1H3,(H,32,34) |
| InChIKey | NEPYRSWZAWXERD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |