C30H32N2O5S — CID 171685436
N-[4-[1-[4-(cyclopropylmethoxy)benzoyl]piperidin-4-yl]phenyl]-3-methylsulfonylbenzamide (PubChem CID 171685436) has the molecular formula C30H32N2O5S and a molecular weight of 532.66 g/mol. Its IUPAC name is N-[4-[1-[4-(cyclopropylmethoxy)benzoyl]piperidin-4-yl]phenyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[4-[1-[4-(cyclopropylmethoxy)benzoyl]piperidin-4-yl]phenyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 171685436 |
| Molecular Formula | C30H32N2O5S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | N-[4-[1-[4-(cyclopropylmethoxy)benzoyl]piperidin-4-yl]phenyl]-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)Nc2ccc(C3CCN(C(=O)c4ccc(OCC5CC5)cc4)CC3)cc2)c1 |
| InChI | InChI=1S/C30H32N2O5S/c1-38(35,36)28-4-2-3-25(19-28)29(33)31-26-11-7-22(8-12-26)23-15-17-32(18-16-23)30(34)24-9-13-27(14-10-24)37-20-21-5-6-21/h2-4,7-14,19,21,23H,5-6,15-18,20H2,1H3,(H,31,33) |
| InChIKey | MZXTXOANPLLAPT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |