C28H24BrN5O4 — CID 171681316
5-bromo-2-methyl-3-nitro-N-[4-[1-(quinoxaline-6-carbonyl)piperidin-4-yl]phenyl]benzamide (PubChem CID 171681316) has the molecular formula C28H24BrN5O4 and a molecular weight of 574.44 g/mol. Its IUPAC name is 5-bromo-2-methyl-3-nitro-N-[4-[1-(quinoxaline-6-carbonyl)piperidin-4-yl]phenyl]benzamide.
| Compound Name | 5-bromo-2-methyl-3-nitro-N-[4-[1-(quinoxaline-6-carbonyl)piperidin-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 171681316 |
| Molecular Formula | C28H24BrN5O4 |
| Molecular Weight | 574.44 g/mol |
| Exact Mass | 573.10 |
| IUPAC Name | 5-bromo-2-methyl-3-nitro-N-[4-[1-(quinoxaline-6-carbonyl)piperidin-4-yl]phenyl]benzamide |
| SMILES | Cc1c(C(=O)Nc2ccc(C3CCN(C(=O)c4ccc5nccnc5c4)CC3)cc2)cc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H24BrN5O4/c1-17-23(15-21(29)16-26(17)34(37)38)27(35)32-22-5-2-18(3-6-22)19-8-12-33(13-9-19)28(36)20-4-7-24-25(14-20)31-11-10-30-24/h2-7,10-11,14-16,19H,8-9,12-13H2,1H3,(H,32,35) |
| InChIKey | DXQFZDOXRCHUNC-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|