C27H27F2N5O4 — CID 171698549
N-[4-[1-[4-(dimethylamino)-3,5-difluorobenzoyl]piperidin-4-yl]phenyl]-4-methyl-5-nitropyridine-2-carboxamide (PubChem CID 171698549) has the molecular formula C27H27F2N5O4 and a molecular weight of 523.54 g/mol. Its IUPAC name is N-[4-[1-[4-(dimethylamino)-3,5-difluorobenzoyl]piperidin-4-yl]phenyl]-4-methyl-5-nitropyridine-2-carboxamide.
| Compound Name | N-[4-[1-[4-(dimethylamino)-3,5-difluorobenzoyl]piperidin-4-yl]phenyl]-4-methyl-5-nitropyridine-2-carboxamide |
|---|---|
| PubChem CID | 171698549 |
| Molecular Formula | C27H27F2N5O4 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | N-[4-[1-[4-(dimethylamino)-3,5-difluorobenzoyl]piperidin-4-yl]phenyl]-4-methyl-5-nitropyridine-2-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(C3CCN(C(=O)c4cc(F)c(N(C)C)c(F)c4)CC3)cc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H27F2N5O4/c1-16-12-23(30-15-24(16)34(37)38)26(35)31-20-6-4-17(5-7-20)18-8-10-33(11-9-18)27(36)19-13-21(28)25(32(2)3)22(29)14-19/h4-7,12-15,18H,8-11H2,1-3H3,(H,31,35) |
| InChIKey | TXGGLKRXPYWNBI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|